C15H14Br2N2O3S — CID 136934908
4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethyl]benzenesulfonamide (PubChem CID 136934908) has the molecular formula C15H14Br2N2O3S and a molecular weight of 462.16 g/mol. Its IUPAC name is 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 136934908 |
| Molecular Formula | C15H14Br2N2O3S |
| Molecular Weight | 462.16 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | 4-[2-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C15H14Br2N2O3S/c16-12-7-11(15(20)14(17)8-12)9-19-6-5-10-1-3-13(4-2-10)23(18,21)22/h1-4,7-9,20H,5-6H2,(H2,18,21,22)/b19-9+ |
| InChIKey | LYDVPSKXQJAOQK-DJKKODMXSA-N |
| XLogP | 3.23 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|