C23H13Cl3N2O6S — CID 126076053
[2,6-dichloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126076053) has the molecular formula C23H13Cl3N2O6S and a molecular weight of 551.79 g/mol. Its IUPAC name is [2,6-dichloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126076053 |
| Molecular Formula | C23H13Cl3N2O6S |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 549.96 |
| IUPAC Name | [2,6-dichloro-4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2)C(=O)/C1=C/c1cc(Cl)c(OS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C23H13Cl3N2O6S/c24-14-5-4-6-15(12-14)28-22(30)17(21(29)27-23(28)31)9-13-10-18(25)20(19(26)11-13)34-35(32,33)16-7-2-1-3-8-16/h1-12H,(H,27,29,31)/b17-9+ |
| InChIKey | WXGMLDCWVKVPRC-RQZCQDPDSA-N |
| XLogP | 5.08 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|