C23H12Cl4N2O6S — CID 126078113
[2,6-dichloro-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126078113) has the molecular formula C23H12Cl4N2O6S and a molecular weight of 586.24 g/mol. Its IUPAC name is [2,6-dichloro-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126078113 |
| Molecular Formula | C23H12Cl4N2O6S |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 583.92 |
| IUPAC Name | [2,6-dichloro-4-[(E)-[1-(2-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccccc2Cl)C(=O)/C1=C/c1cc(Cl)c(OS(=O)(=O)c2ccc(Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H12Cl4N2O6S/c24-13-5-7-14(8-6-13)36(33,34)35-20-17(26)10-12(11-18(20)27)9-15-21(30)28-23(32)29(22(15)31)19-4-2-1-3-16(19)25/h1-11H,(H,28,30,32)/b15-9+ |
| InChIKey | LDFINMBJPRICJQ-OQLLNIDSSA-N |
| XLogP | 5.73 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|