C29H19ClN2O6S — CID 126081118
[2-chloro-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 126081118) has the molecular formula C29H19ClN2O6S and a molecular weight of 559.00 g/mol. Its IUPAC name is [2-chloro-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-chloro-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126081118 |
| Molecular Formula | C29H19ClN2O6S |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | [2-chloro-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | O=C1C(=Cc2ccc(OS(=O)(=O)c3ccccc3)c(Cl)c2)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H19ClN2O6S/c30-25-19-20(16-17-26(25)38-39(36,37)23-14-8-3-9-15-23)18-24-27(33)31(21-10-4-1-5-11-21)29(35)32(28(24)34)22-12-6-2-7-13-22/h1-19H |
| InChIKey | VIKCCSWVKPLGMX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|