C23H15BrN2O7S — CID 126070377
[2-bromo-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126070377) has the molecular formula C23H15BrN2O7S and a molecular weight of 543.35 g/mol. Its IUPAC name is [2-bromo-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-bromo-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126070377 |
| Molecular Formula | C23H15BrN2O7S |
| Molecular Weight | 543.35 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | [2-bromo-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C1NC(=O)N(c2ccc(O)cc2)C(=O)/C1=C/c1ccc(OS(=O)(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H15BrN2O7S/c24-19-13-14(6-11-20(19)33-34(31,32)17-4-2-1-3-5-17)12-18-21(28)25-23(30)26(22(18)29)15-7-9-16(27)10-8-15/h1-13,27H,(H,25,28,30)/b18-12+ |
| InChIKey | BCRWCUKIZKGJOY-LDADJPATSA-N |
| XLogP | 3.59 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|