C32H26N2O8S — CID 126074387
[2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126074387) has the molecular formula C32H26N2O8S and a molecular weight of 598.63 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126074387 |
| Molecular Formula | C32H26N2O8S |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | [2-ethoxy-4-[(E)-[2,4,6-trioxo-1-(4-phenylmethoxyphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H26N2O8S/c1-2-40-29-20-23(13-18-28(29)42-43(38,39)26-11-7-4-8-12-26)19-27-30(35)33-32(37)34(31(27)36)24-14-16-25(17-15-24)41-21-22-9-5-3-6-10-22/h3-20H,2,21H2,1H3,(H,33,35,37)/b27-19+ |
| InChIKey | FHQMVUDYPUHOAC-ZXVVBBHZSA-N |
| XLogP | 5.10 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|