C27H22Cl2N2O4 — CID 126053554
5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126053554) has the molecular formula C27H22Cl2N2O4 and a molecular weight of 509.39 g/mol. Its IUPAC name is 5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126053554 |
| Molecular Formula | C27H22Cl2N2O4 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 5-[[3,5-dichloro-4-(2-methylpropoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)COc1c(Cl)cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc1Cl |
| InChI | InChI=1S/C27H22Cl2N2O4/c1-17(2)16-35-24-22(28)14-18(15-23(24)29)13-21-25(32)30(19-9-5-3-6-10-19)27(34)31(26(21)33)20-11-7-4-8-12-20/h3-15,17H,16H2,1-2H3 |
| InChIKey | MWQGXIVYLFANCT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|