C28H24N2O6 — CID 126193061
propan-2-yl 2-[4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 126193061) has the molecular formula C28H24N2O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126193061 |
| Molecular Formula | C28H24N2O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | propan-2-yl 2-[4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H24N2O6/c1-19(2)36-25(31)18-35-23-15-13-20(14-16-23)17-24-26(32)29(21-9-5-3-6-10-21)28(34)30(27(24)33)22-11-7-4-8-12-22/h3-17,19H,18H2,1-2H3 |
| InChIKey | IEMXJYQPBDJBFE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|