C25H19N3O5 — CID 126232058
2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126232058) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126232058 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C25H19N3O5/c26-22(29)16-33-20-13-7-8-17(14-20)15-21-23(30)27(18-9-3-1-4-10-18)25(32)28(24(21)31)19-11-5-2-6-12-19/h1-15H,16H2,(H2,26,29) |
| InChIKey | RPOYBVKAKIEFHZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|