C19H13ClN2O5S — CID 91568056
2-[3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 91568056) has the molecular formula C19H13ClN2O5S and a molecular weight of 416.84 g/mol. Its IUPAC name is 2-[3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91568056 |
| Molecular Formula | C19H13ClN2O5S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2-[3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H13ClN2O5S/c20-12-4-6-13(7-5-12)22-18(26)15(17(25)21-19(22)28)9-11-2-1-3-14(8-11)27-10-16(23)24/h1-9H,10H2,(H,23,24)(H,21,25,28) |
| InChIKey | DPUHPWGDUXACNV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|