C25H18N2O5S — CID 6513736
3-[[3-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 6513736) has the molecular formula C25H18N2O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-[[3-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[3-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 6513736 |
| Molecular Formula | C25H18N2O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 3-[[3-[(E)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2ccccc2)C(=O)/C1=C/c1cccc(OCc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C25H18N2O5S/c28-22-21(23(29)27(25(33)26-22)19-9-2-1-3-10-19)14-16-6-5-11-20(13-16)32-15-17-7-4-8-18(12-17)24(30)31/h1-14H,15H2,(H,30,31)(H,26,28,33)/b21-14+ |
| InChIKey | UNXBURJFSIEEJL-KGENOOAVSA-N |
| XLogP | 3.80 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|