C29H19IN2O5S — CID 4002885
3-[5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4002885) has the molecular formula C29H19IN2O5S and a molecular weight of 634.45 g/mol. Its IUPAC name is 3-[5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4002885 |
| Molecular Formula | C29H19IN2O5S |
| Molecular Weight | 634.45 g/mol |
| Exact Mass | 634.01 |
| IUPAC Name | 3-[5-[[3-iodo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1ccc(OCc2ccc3ccccc3c2)c(I)c1 |
| InChI | InChI=1S/C29H19IN2O5S/c30-24-14-17(9-11-25(24)37-16-18-8-10-19-4-1-2-5-20(19)12-18)13-23-26(33)31-29(38)32(27(23)34)22-7-3-6-21(15-22)28(35)36/h1-15H,16H2,(H,35,36)(H,31,33,38) |
| InChIKey | JLJMBXHSZQENQK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|