C26H18N2O7S — CID 3963454
3-[5-[[4-[(4-carboxyphenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3963454) has the molecular formula C26H18N2O7S and a molecular weight of 502.50 g/mol. Its IUPAC name is 3-[5-[[4-[(4-carboxyphenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[4-[(4-carboxyphenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3963454 |
| Molecular Formula | C26H18N2O7S |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 3-[5-[[4-[(4-carboxyphenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1ccc(OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H18N2O7S/c29-22-21(23(30)28(26(36)27-22)19-3-1-2-18(13-19)25(33)34)12-15-6-10-20(11-7-15)35-14-16-4-8-17(9-5-16)24(31)32/h1-13H,14H2,(H,31,32)(H,33,34)(H,27,29,36) |
| InChIKey | ZZAKVZZZXWWCPG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|