C25H17FN2O5S — CID 3634499
3-[5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 3634499) has the molecular formula C25H17FN2O5S and a molecular weight of 476.49 g/mol. Its IUPAC name is 3-[5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3634499 |
| Molecular Formula | C25H17FN2O5S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 3-[5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H17FN2O5S/c26-21-7-2-1-4-17(21)14-33-19-10-8-15(9-11-19)12-20-22(29)27-25(34)28(23(20)30)18-6-3-5-16(13-18)24(31)32/h1-13H,14H2,(H,31,32)(H,27,29,34) |
| InChIKey | XIMGNFCDNWHTHB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|