C25H16BrClN2O5S — CID 4009991
3-[5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4009991) has the molecular formula C25H16BrClN2O5S and a molecular weight of 571.84 g/mol. Its IUPAC name is 3-[5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4009991 |
| Molecular Formula | C25H16BrClN2O5S |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 569.97 |
| IUPAC Name | 3-[5-[[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1cc(Br)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H16BrClN2O5S/c26-17-8-9-21(34-13-15-4-1-2-7-20(15)27)16(10-17)12-19-22(30)28-25(35)29(23(19)31)18-6-3-5-14(11-18)24(32)33/h1-12H,13H2,(H,32,33)(H,28,30,35) |
| InChIKey | NIMRSVNSMPWHDO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|