C25H15BrFN3O3S — CID 124533002
2-[[4-bromo-2-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 124533002) has the molecular formula C25H15BrFN3O3S and a molecular weight of 536.38 g/mol. Its IUPAC name is 2-[[4-bromo-2-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-bromo-2-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124533002 |
| Molecular Formula | C25H15BrFN3O3S |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | 2-[[4-bromo-2-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(Br)cc1/C=C1\C(=O)NC(=S)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C25H15BrFN3O3S/c26-18-9-10-22(33-14-16-6-2-1-5-15(16)13-28)17(11-18)12-19-23(31)29-25(34)30(24(19)32)21-8-4-3-7-20(21)27/h1-12H,14H2,(H,29,31,34)/b19-12+ |
| InChIKey | LTOVNXTVAZIZGL-XDHOZWIPSA-N |
| XLogP | 4.87 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|