C30H21N3O4 — CID 21378017
2-[[1-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile (PubChem CID 21378017) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is 2-[[1-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile.
| Compound Name | 2-[[1-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 21378017 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-[[1-[(E)-[1-(2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzonitrile |
| SMILES | Cc1ccccc1N1C(=O)NC(=O)/C(=C\c2c(OCc3ccccc3C#N)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C30H21N3O4/c1-19-8-2-7-13-26(19)33-29(35)25(28(34)32-30(33)36)16-24-23-12-6-5-9-20(23)14-15-27(24)37-18-22-11-4-3-10-21(22)17-31/h2-16H,18H2,1H3,(H,32,34,36)/b25-16+ |
| InChIKey | IJOPAHMPDQBSNT-PCLIKHOPSA-N |
| XLogP | 5.27 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|