C33H28N4O3S — CID 126250137
2-[[4-[3-[(E)-[1-(2,5-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile (PubChem CID 126250137) has the molecular formula C33H28N4O3S and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[[4-[3-[(E)-[1-(2,5-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[3-[(E)-[1-(2,5-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126250137 |
| Molecular Formula | C33H28N4O3S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 2-[[4-[3-[(E)-[1-(2,5-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
| SMILES | Cc1ccc(C)c(N2C(=O)/C(=C/c3cc(C)n(-c4ccc(OCc5ccccc5C#N)cc4)c3C)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C33H28N4O3S/c1-20-9-10-21(2)30(15-20)37-32(39)29(31(38)35-33(37)41)17-26-16-22(3)36(23(26)4)27-11-13-28(14-12-27)40-19-25-8-6-5-7-24(25)18-34/h5-17H,19H2,1-4H3,(H,35,38,41)/b29-17+ |
| InChIKey | ZPAQCCVHOVSDGB-STBIYBPSSA-N |
| XLogP | 5.99 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|