C32H23F3N4O3S — CID 126247967
2-[[4-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile (PubChem CID 126247967) has the molecular formula C32H23F3N4O3S and a molecular weight of 600.62 g/mol. Its IUPAC name is 2-[[4-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126247967 |
| Molecular Formula | C32H23F3N4O3S |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | 2-[[4-[3-[(E)-[4,6-dioxo-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinan-5-ylidene]methyl]-2,5-dimethylpyrrol-1-yl]phenoxy]methyl]benzonitrile |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)c(C)n1-c1ccc(OCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C32H23F3N4O3S/c1-19-14-23(15-28-29(40)37-31(43)39(30(28)41)26-9-5-8-24(16-26)32(33,34)35)20(2)38(19)25-10-12-27(13-11-25)42-18-22-7-4-3-6-21(22)17-36/h3-16H,18H2,1-2H3,(H,37,40,43)/b28-15+ |
| InChIKey | YOYAXZFUDFGPDD-RWPZCVJISA-N |
| XLogP | 6.39 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|