C30H21F3N4O4S2 — CID 126247389
(5E)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-4,6-dione (PubChem CID 126247389) has the molecular formula C30H21F3N4O4S2 and a molecular weight of 622.65 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126247389 |
| Molecular Formula | C30H21F3N4O4S2 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-4,6-dione |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)c(C)n1-c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H21F3N4O4S2/c1-17-14-19(15-26-27(38)34-29(42)36(28(26)39)23-5-3-4-20(16-23)30(31,32)33)18(2)35(17)21-6-10-24(11-7-21)43-25-12-8-22(9-13-25)37(40)41/h3-16H,1-2H3,(H,34,38,42)/b26-15+ |
| InChIKey | JKTZILYIJQCNLE-CVKSISIWSA-N |
| XLogP | 7.00 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|