C24H15FIN3O5S — CID 124532801
(5E)-1-(2-fluorophenyl)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 124532801) has the molecular formula C24H15FIN3O5S and a molecular weight of 603.37 g/mol. Its IUPAC name is (5E)-1-(2-fluorophenyl)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(2-fluorophenyl)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 124532801 |
| Molecular Formula | C24H15FIN3O5S |
| Molecular Weight | 603.37 g/mol |
| Exact Mass | 602.98 |
| IUPAC Name | (5E)-1-(2-fluorophenyl)-5-[[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccccc2F)C(=O)/C1=C/c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(I)c1 |
| InChI | InChI=1S/C24H15FIN3O5S/c25-18-3-1-2-4-20(18)28-23(31)17(22(30)27-24(28)35)11-15-7-10-21(19(26)12-15)34-13-14-5-8-16(9-6-14)29(32)33/h1-12H,13H2,(H,27,30,35)/b17-11+ |
| InChIKey | DAYWYNSDWHRGAT-GZTJUZNOSA-N |
| XLogP | 4.75 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|