C24H16N2O5S — CID 91005496
3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzoic acid (PubChem CID 91005496) has the molecular formula C24H16N2O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzoic acid.
| Compound Name | 3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 91005496 |
| Molecular Formula | C24H16N2O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H16N2O5S/c27-21-20(14-15-5-4-6-16(13-15)23(29)30)22(28)26(24(32)25-21)17-9-11-19(12-10-17)31-18-7-2-1-3-8-18/h1-14H,(H,29,30)(H,25,27,32) |
| InChIKey | WDOWKLHNSSRAKZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|