C28H18N2O6S — CID 90700708
3-[5-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 90700708) has the molecular formula C28H18N2O6S and a molecular weight of 510.53 g/mol. Its IUPAC name is 3-[5-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 90700708 |
| Molecular Formula | C28H18N2O6S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 3-[5-[[4,6-dioxo-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C28H18N2O6S/c31-25-23(16-22-13-14-24(36-22)17-5-4-6-18(15-17)27(33)34)26(32)30(28(37)29-25)19-9-11-21(12-10-19)35-20-7-2-1-3-8-20/h1-16H,(H,33,34)(H,29,31,37) |
| InChIKey | ITXYWQVHHLQHFA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|