C23H14N2O7S — CID 3525379
2-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 3525379) has the molecular formula C23H14N2O7S and a molecular weight of 462.44 g/mol. Its IUPAC name is 2-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3525379 |
| Molecular Formula | C23H14N2O7S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 2-[5-[[1-(3-carboxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=Cc1ccc(-c2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C23H14N2O7S/c26-19-17(11-14-8-9-18(32-14)15-6-1-2-7-16(15)22(30)31)20(27)25(23(33)24-19)13-5-3-4-12(10-13)21(28)29/h1-11H,(H,28,29)(H,30,31)(H,24,26,33) |
| InChIKey | YSBPXMOVXCACRN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|