C25H17FN2O6 — CID 2918409
3-[[4-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 2918409) has the molecular formula C25H17FN2O6 and a molecular weight of 460.42 g/mol. Its IUPAC name is 3-[[4-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 2918409 |
| Molecular Formula | C25H17FN2O6 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 3-[[4-[[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C1NC(=O)N(c2ccc(F)cc2)C(=O)C1=Cc1ccc(OCc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H17FN2O6/c26-18-6-8-19(9-7-18)28-23(30)21(22(29)27-25(28)33)13-15-4-10-20(11-5-15)34-14-16-2-1-3-17(12-16)24(31)32/h1-13H,14H2,(H,31,32)(H,27,29,33) |
| InChIKey | QSKHLBWKRBWAMM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|