C31H22FN3O5 — CID 126388174
N-(2-fluorophenyl)-2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126388174) has the molecular formula C31H22FN3O5 and a molecular weight of 535.53 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126388174 |
| Molecular Formula | C31H22FN3O5 |
| Molecular Weight | 535.53 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)c1)Nc1ccccc1F |
| InChI | InChI=1S/C31H22FN3O5/c32-26-16-7-8-17-27(26)33-28(36)20-40-24-15-9-10-21(18-24)19-25-29(37)34(22-11-3-1-4-12-22)31(39)35(30(25)38)23-13-5-2-6-14-23/h1-19H,20H2,(H,33,36) |
| InChIKey | XYGBFTZSIQJDPQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|