C9H10ClN3O3 — CID 141161863
2-[2-(carbamoylamino)-4-chlorophenoxy]acetamide (PubChem CID 141161863) has the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)-4-chlorophenoxy]acetamide.
| Compound Name | 2-[2-(carbamoylamino)-4-chlorophenoxy]acetamide |
|---|---|
| PubChem CID | 141161863 |
| Molecular Formula | C9H10ClN3O3 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-[2-(carbamoylamino)-4-chlorophenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Cl)cc1NC(N)=O |
| InChI | InChI=1S/C9H10ClN3O3/c10-5-1-2-7(16-4-8(11)14)6(3-5)13-9(12)15/h1-3H,4H2,(H2,11,14)(H3,12,13,15) |
| InChIKey | PQNGLZSJCXQIDC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |