C11H16Cl2N2O3 — CID 17053988
2-[4-chloro-2-[(2-hydroxyethylamino)methyl]phenoxy]acetamide;hydrochloride (PubChem CID 17053988) has the molecular formula C11H16Cl2N2O3 and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2-hydroxyethylamino)methyl]phenoxy]acetamide;hydrochloride.
| Compound Name | 2-[4-chloro-2-[(2-hydroxyethylamino)methyl]phenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 17053988 |
| Molecular Formula | C11H16Cl2N2O3 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[4-chloro-2-[(2-hydroxyethylamino)methyl]phenoxy]acetamide;hydrochloride |
| SMILES | Cl.NC(=O)COc1ccc(Cl)cc1CNCCO |
| InChI | InChI=1S/C11H15ClN2O3.ClH/c12-9-1-2-10(17-7-11(13)16)8(5-9)6-14-3-4-15;/h1-2,5,14-15H,3-4,6-7H2,(H2,13,16);1H |
| InChIKey | JRUHRYVWDBURIJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|