C26H20BrN5 — CID 6474451
N'-[(E)-[1-[(2-bromophenyl)methyl]indol-3-yl]methylideneamino]quinoline-2-carboximidamide (PubChem CID 6474451) has the molecular formula C26H20BrN5 and a molecular weight of 482.39 g/mol. Its IUPAC name is N'-[(E)-[1-[(2-bromophenyl)methyl]indol-3-yl]methylideneamino]quinoline-2-carboximidamide.
| Compound Name | N'-[(E)-[1-[(2-bromophenyl)methyl]indol-3-yl]methylideneamino]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 6474451 |
| Molecular Formula | C26H20BrN5 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N'-[(E)-[1-[(2-bromophenyl)methyl]indol-3-yl]methylideneamino]quinoline-2-carboximidamide |
| SMILES | N/C(=N/N=C/c1cn(Cc2ccccc2Br)c2ccccc12)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H20BrN5/c27-22-10-4-1-8-19(22)16-32-17-20(21-9-3-6-12-25(21)32)15-29-31-26(28)24-14-13-18-7-2-5-11-23(18)30-24/h1-15,17H,16H2,(H2,28,31)/b29-15+ |
| InChIKey | GSLJTOPCNSOQAA-WKULSOCRSA-N |
| XLogP | 5.74 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|