C32H22Cl4N4 — CID 3938272
1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine (PubChem CID 3938272) has the molecular formula C32H22Cl4N4 and a molecular weight of 604.37 g/mol. Its IUPAC name is 1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine.
| Compound Name | 1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 3938272 |
| Molecular Formula | C32H22Cl4N4 |
| Molecular Weight | 604.37 g/mol |
| Exact Mass | 602.06 |
| IUPAC Name | 1-[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]-N-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylideneamino]methanimine |
| SMILES | Clc1cccc(Cl)c1Cn1cc(C=NN=Cc2cn(Cc3c(Cl)cccc3Cl)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C32H22Cl4N4/c33-27-9-5-10-28(34)25(27)19-39-17-21(23-7-1-3-13-31(23)39)15-37-38-16-22-18-40(32-14-4-2-8-24(22)32)20-26-29(35)11-6-12-30(26)36/h1-18H,19-20H2 |
| InChIKey | RDKGPVHIBRQABA-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.37 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|