C23H19N5O3S2 — CID 170918207
(Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170918207) has the molecular formula C23H19N5O3S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918207 |
| Molecular Formula | C23H19N5O3S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (Z)-2-cyano-3-[1-[(4-methylphenyl)methyl]indol-3-yl]-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc(Cn2cc(/C=C(/C#N)C(=O)Nc3nc(S(C)(=O)=O)ns3)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N5O3S2/c1-15-7-9-16(10-8-15)13-28-14-18(19-5-3-4-6-20(19)28)11-17(12-24)21(29)25-22-26-23(27-32-22)33(2,30)31/h3-11,14H,13H2,1-2H3,(H,25,26,27,29)/b17-11- |
| InChIKey | BJMQBOITWTWEQH-BOPFTXTBSA-N |
| XLogP | 3.80 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|