C24H23N3O3 — CID 71553073
ethyl 2-[3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]-4-methylindol-1-yl]acetate (PubChem CID 71553073) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is ethyl 2-[3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]-4-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]-4-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 71553073 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 2-[3-[(E)-2-cyano-3-(N-methylanilino)-3-oxoprop-1-enyl]-4-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(/C=C(\C#N)C(=O)N(C)c2ccccc2)c2c(C)cccc21 |
| InChI | InChI=1S/C24H23N3O3/c1-4-30-22(28)16-27-15-19(23-17(2)9-8-12-21(23)27)13-18(14-25)24(29)26(3)20-10-6-5-7-11-20/h5-13,15H,4,16H2,1-3H3/b18-13+ |
| InChIKey | VLPVPTUZSGPLQU-QGOAFFKASA-N |
| XLogP | 4.08 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|