C25H23N5O2 — CID 3148331
2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enenitrile (PubChem CID 3148331) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3148331 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-(6-methyl-1H-benzimidazol-2-yl)-3-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]prop-2-enenitrile |
| SMILES | Cc1ccc2nc(C(C#N)=Cc3cn(CC(=O)N4CCOCC4)c4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C25H23N5O2/c1-17-6-7-21-22(12-17)28-25(27-21)18(14-26)13-19-15-30(23-5-3-2-4-20(19)23)16-24(31)29-8-10-32-11-9-29/h2-7,12-13,15H,8-11,16H2,1H3,(H,27,28) |
| InChIKey | WNXRGDWADVXFKZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|