C18H13Cl2N3 — CID 110536384
(Z)-3-(2,3-dichlorophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 110536384) has the molecular formula C18H13Cl2N3 and a molecular weight of 342.23 g/mol. Its IUPAC name is (Z)-3-(2,3-dichlorophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2,3-dichlorophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 110536384 |
| Molecular Formula | C18H13Cl2N3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (Z)-3-(2,3-dichlorophenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc2nc(/C(C#N)=C\c3cccc(Cl)c3Cl)[nH]c2cc1C |
| InChI | InChI=1S/C18H13Cl2N3/c1-10-6-15-16(7-11(10)2)23-18(22-15)13(9-21)8-12-4-3-5-14(19)17(12)20/h3-8H,1-2H3,(H,22,23)/b13-8- |
| InChIKey | ZVKUUBZMILTAJI-JYRVWZFOSA-N |
| XLogP | 5.55 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|