C27H25N3O2 — CID 110531139
(Z)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 110531139) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (Z)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 110531139 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (Z)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)-3-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | COc1cccc(/C=C(/C#N)c2nc3cc(C)c(C)cc3[nH]2)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H25N3O2/c1-17-7-5-8-20(11-17)16-32-26-21(9-6-10-25(26)31-4)14-22(15-28)27-29-23-12-18(2)19(3)13-24(23)30-27/h5-14H,16H2,1-4H3,(H,29,30)/b22-14- |
| InChIKey | LSDJDDITDLNEIZ-HMAPJEAMSA-N |
| XLogP | 6.14 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|