C16H11Cl2NO4 — CID 2732170
4-[2-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid (PubChem CID 2732170) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[2-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2732170 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 4-[2-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO4/c17-10-5-6-13(11(18)9-10)23-14-4-2-1-3-12(14)19-15(20)7-8-16(21)22/h1-9H,(H,19,20)(H,21,22) |
| InChIKey | UXSDKTQGIRAEJG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|