(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid

C16H11Cl2NO4 — CID 25251032

IUPAC(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C\C(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1
InChIInChI=1S/C16H11Cl2NO4/c17-10-1-6-14(13(18)9-10)23-12-4-2-11(3-5-12)19-15(20)7-8-16(21)22/h1-9H,(H,19,20)(H,21,22)/b8-7-
InChIKeyFGSOGUFVJAZBNH-FPLPWBNLSA-N
MW352.17 g/mol
LogP4.36
Rot. Bonds5

About (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid

(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid (PubChem CID 25251032) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid
PubChem CID25251032
Molecular FormulaC16H11Cl2NO4
Molecular Weight352.17 g/mol
Exact Mass351.01
IUPAC Name(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C\C(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1
InChIInChI=1S/C16H11Cl2NO4/c17-10-1-6-14(13(18)9-10)23-12-4-2-11(3-5-12)19-15(20)7-8-16(21)22/h1-9H,(H,19,20)(H,21,22)/b8-7-
InChIKeyFGSOGUFVJAZBNH-FPLPWBNLSA-N
XLogP4.36
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.17
LogP ≤ 54.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid?
The IUPAC name of (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid (CID 25251032) is (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid?
The canonical SMILES for (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid is O=C(O)/C=C\C(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid?
The InChIKey is FGSOGUFVJAZBNH-FPLPWBNLSA-N. The full InChI is InChI=1S/C16H11Cl2NO4/c17-10-1-6-14(13(18)9-10)23-12-4-2-11(3-5-12)19-15(20)7-8-16(21)22/h1-9H,(H,19,20)(H,21,22)/b8-7-.
What are the key properties of (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid?
(Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid has a molecular weight of 352.17 g/mol, XLogP of 4.36, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[4-(2,4-dichlorophenoxy)anilino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 25251032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).