C19H18ClNO3 — CID 46930514
(2E,4E)-N-[4-(4-chloro-2-methoxyphenoxy)phenyl]hexa-2,4-dienamide (PubChem CID 46930514) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is (2E,4E)-N-[4-(4-chloro-2-methoxyphenoxy)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[4-(4-chloro-2-methoxyphenoxy)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 46930514 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2E,4E)-N-[4-(4-chloro-2-methoxyphenoxy)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccc(Oc2ccc(Cl)cc2OC)cc1 |
| InChI | InChI=1S/C19H18ClNO3/c1-3-4-5-6-19(22)21-15-8-10-16(11-9-15)24-17-12-7-14(20)13-18(17)23-2/h3-13H,1-2H3,(H,21,22)/b4-3+,6-5+ |
| InChIKey | OBGHWJWXESCUKN-VNKDHWASSA-N |
| XLogP | 5.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|