C14H16FNO3 — CID 72688712
N-(2-fluoro-4,5-dimethoxyphenyl)hexa-2,4-dienamide (PubChem CID 72688712) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(2-fluoro-4,5-dimethoxyphenyl)hexa-2,4-dienamide.
| Compound Name | N-(2-fluoro-4,5-dimethoxyphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 72688712 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(2-fluoro-4,5-dimethoxyphenyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)Nc1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C14H16FNO3/c1-4-5-6-7-14(17)16-11-9-13(19-3)12(18-2)8-10(11)15/h4-9H,1-3H3,(H,16,17) |
| InChIKey | HFVRINPBJOEHEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|