C14H16ClNO3 — CID 9439076
(2E,4E)-N-(4-chloro-2,5-dimethoxyphenyl)hexa-2,4-dienamide (PubChem CID 9439076) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is (2E,4E)-N-(4-chloro-2,5-dimethoxyphenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(4-chloro-2,5-dimethoxyphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 9439076 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (2E,4E)-N-(4-chloro-2,5-dimethoxyphenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C14H16ClNO3/c1-4-5-6-7-14(17)16-11-9-12(18-2)10(15)8-13(11)19-3/h4-9H,1-3H3,(H,16,17)/b5-4+,7-6+ |
| InChIKey | MIFBFPNWRISOHB-YTXTXJHMSA-N |
| XLogP | 3.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|