C12H12ClNO5 — CID 2803499
4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoic acid (PubChem CID 2803499) has the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. Its IUPAC name is 4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoic acid.
| Compound Name | 4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2803499 |
| Molecular Formula | C12H12ClNO5 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoic acid |
| SMILES | COc1cc(OC)c(NC(=O)C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C12H12ClNO5/c1-18-9-6-10(19-2)8(5-7(9)13)14-11(15)3-4-12(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | OMMWQXYUXSUUCA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|