C19H17NO3 — CID 26664579
(2E,4E)-N-(2-methoxydibenzofuran-3-yl)hexa-2,4-dienamide (PubChem CID 26664579) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2E,4E)-N-(2-methoxydibenzofuran-3-yl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-methoxydibenzofuran-3-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 26664579 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2E,4E)-N-(2-methoxydibenzofuran-3-yl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cc2oc3ccccc3c2cc1OC |
| InChI | InChI=1S/C19H17NO3/c1-3-4-5-10-19(21)20-15-12-17-14(11-18(15)22-2)13-8-6-7-9-16(13)23-17/h3-12H,1-2H3,(H,20,21)/b4-3+,10-5+ |
| InChIKey | YVLHXHHJZGUZGY-COBAKMAKSA-N |
| XLogP | 4.67 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|