C13H19Cl2N3O2 — CID 119713991
5-chloro-N-methyl-2-[[2-methyl-3-(methylamino)propanoyl]amino]benzamide;hydrochloride (PubChem CID 119713991) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 5-chloro-N-methyl-2-[[2-methyl-3-(methylamino)propanoyl]amino]benzamide;hydrochloride.
| Compound Name | 5-chloro-N-methyl-2-[[2-methyl-3-(methylamino)propanoyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119713991 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-chloro-N-methyl-2-[[2-methyl-3-(methylamino)propanoyl]amino]benzamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1ccc(Cl)cc1C(=O)NC.Cl |
| InChI | InChI=1S/C13H18ClN3O2.ClH/c1-8(7-15-2)12(18)17-11-5-4-9(14)6-10(11)13(19)16-3;/h4-6,8,15H,7H2,1-3H3,(H,16,19)(H,17,18);1H |
| InChIKey | FAXHGTZIJUKMGP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |