C19H24ClF2N3O4 — CID 171845332
5-chloro-N-[(3S)-6,6-difluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]-2-(2-methylpropanoylamino)benzamide (PubChem CID 171845332) has the molecular formula C19H24ClF2N3O4 and a molecular weight of 431.87 g/mol. Its IUPAC name is 5-chloro-N-[(3S)-6,6-difluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]-2-(2-methylpropanoylamino)benzamide.
| Compound Name | 5-chloro-N-[(3S)-6,6-difluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]-2-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 171845332 |
| Molecular Formula | C19H24ClF2N3O4 |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-chloro-N-[(3S)-6,6-difluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]-2-(2-methylpropanoylamino)benzamide |
| SMILES | CNC(=O)C(=O)[C@H](CCC(C)(F)F)NC(=O)c1cc(Cl)ccc1NC(=O)C(C)C |
| InChI | InChI=1S/C19H24ClF2N3O4/c1-10(2)16(27)24-13-6-5-11(20)9-12(13)17(28)25-14(7-8-19(3,21)22)15(26)18(29)23-4/h5-6,9-10,14H,7-8H2,1-4H3,(H,23,29)(H,24,27)(H,25,28)/t14-/m0/s1 |
| InChIKey | CTOLZYUZKUNJRQ-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|