C17H21ClFN3O5 — CID 171845358
methyl N-[4-chloro-2-[[(3S)-6-fluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]carbamoyl]phenyl]carbamate (PubChem CID 171845358) has the molecular formula C17H21ClFN3O5 and a molecular weight of 401.82 g/mol. Its IUPAC name is methyl N-[4-chloro-2-[[(3S)-6-fluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]carbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[4-chloro-2-[[(3S)-6-fluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 171845358 |
| Molecular Formula | C17H21ClFN3O5 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | methyl N-[4-chloro-2-[[(3S)-6-fluoro-1-(methylamino)-1,2-dioxoheptan-3-yl]carbamoyl]phenyl]carbamate |
| SMILES | CNC(=O)C(=O)[C@H](CCC(C)F)NC(=O)c1cc(Cl)ccc1NC(=O)OC |
| InChI | InChI=1S/C17H21ClFN3O5/c1-9(19)4-6-13(14(23)16(25)20-2)21-15(24)11-8-10(18)5-7-12(11)22-17(26)27-3/h5,7-9,13H,4,6H2,1-3H3,(H,20,25)(H,21,24)(H,22,26)/t9?,13-/m0/s1 |
| InChIKey | VNLQXXFJLRVQQN-NCWAPJAISA-N |
| XLogP | 2.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|