C17H8Cl2F3N3O2S — CID 168542419
2-[[4-chloro-2-(4-chlorophenyl)sulfonyl-5-(trifluoromethyl)anilino]methylidene]propanedinitrile (PubChem CID 168542419) has the molecular formula C17H8Cl2F3N3O2S and a molecular weight of 446.24 g/mol. Its IUPAC name is 2-[[4-chloro-2-(4-chlorophenyl)sulfonyl-5-(trifluoromethyl)anilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-chloro-2-(4-chlorophenyl)sulfonyl-5-(trifluoromethyl)anilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168542419 |
| Molecular Formula | C17H8Cl2F3N3O2S |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 2-[[4-chloro-2-(4-chlorophenyl)sulfonyl-5-(trifluoromethyl)anilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1cc(C(F)(F)F)c(Cl)cc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H8Cl2F3N3O2S/c18-11-1-3-12(4-2-11)28(26,27)16-6-14(19)13(17(20,21)22)5-15(16)25-9-10(7-23)8-24/h1-6,9,25H |
| InChIKey | FAIQVCBQHOGBFN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|