C30H28N4O6S3 — CID 70443259
N-[4,8-diamino-3,7-dimethyl-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-6-sulfanylanthracen-1-yl]-4-methylbenzenesulfonamide (PubChem CID 70443259) has the molecular formula C30H28N4O6S3 and a molecular weight of 636.78 g/mol. Its IUPAC name is N-[4,8-diamino-3,7-dimethyl-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-6-sulfanylanthracen-1-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4,8-diamino-3,7-dimethyl-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-6-sulfanylanthracen-1-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 70443259 |
| Molecular Formula | C30H28N4O6S3 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.12 |
| IUPAC Name | N-[4,8-diamino-3,7-dimethyl-5-[(4-methylphenyl)sulfonylamino]-9,10-dioxo-6-sulfanylanthracen-1-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C)c(N)c3c2C(=O)c2c(N)c(C)c(S)c(NS(=O)(=O)c4ccc(C)cc4)c2C3=O)cc1 |
| InChI | InChI=1S/C30H28N4O6S3/c1-14-5-9-18(10-6-14)42(37,38)33-20-13-16(3)25(31)22-21(20)28(35)23-24(29(22)36)27(30(41)17(4)26(23)32)34-43(39,40)19-11-7-15(2)8-12-19/h5-13,33-34,41H,31-32H2,1-4H3 |
| InChIKey | WMEGMZXBIWTQMV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|