C22H24N4O6S2 — CID 118497707
methyl 3,4-diamino-2,5-bis[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 118497707) has the molecular formula C22H24N4O6S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is methyl 3,4-diamino-2,5-bis[(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | methyl 3,4-diamino-2,5-bis[(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 118497707 |
| Molecular Formula | C22H24N4O6S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | methyl 3,4-diamino-2,5-bis[(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2ccc(C)cc2)c(N)c(N)c1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24N4O6S2/c1-13-4-8-15(9-5-13)33(28,29)25-18-12-17(22(27)32-3)21(20(24)19(18)23)26-34(30,31)16-10-6-14(2)7-11-16/h4-12,25-26H,23-24H2,1-3H3 |
| InChIKey | KRHBUJNKMJBMMX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|