methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate

C17H19NO6S — CID 139249633

IUPACmethyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate
SMILESCOC(=O)c1ccc(OC)c(NS(=O)(=O)c2ccc(C)cc2)c1OC
InChIInChI=1S/C17H19NO6S/c1-11-5-7-12(8-6-11)25(20,21)18-15-14(22-2)10-9-13(16(15)23-3)17(19)24-4/h5-10,18H,1-4H3
InChIKeyAICQYJFTGXHMSB-UHFFFAOYSA-N
MW365.41 g/mol
LogP2.60
Rot. Bonds6

About methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate

methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 139249633) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate.

Molecular Properties

Compound Namemethyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate
PubChem CID139249633
Molecular FormulaC17H19NO6S
Molecular Weight365.41 g/mol
Exact Mass365.09
IUPAC Namemethyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate
SMILESCOC(=O)c1ccc(OC)c(NS(=O)(=O)c2ccc(C)cc2)c1OC
InChIInChI=1S/C17H19NO6S/c1-11-5-7-12(8-6-11)25(20,21)18-15-14(22-2)10-9-13(16(15)23-3)17(19)24-4/h5-10,18H,1-4H3
InChIKeyAICQYJFTGXHMSB-UHFFFAOYSA-N
XLogP2.60
TPSA90.93 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.41
LogP ≤ 52.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate?
The IUPAC name of methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate (CID 139249633) is methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate.
What is the SMILES notation for methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate?
The canonical SMILES for methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate is COC(=O)c1ccc(OC)c(NS(=O)(=O)c2ccc(C)cc2)c1OC.
What is the InChIKey of methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate?
The InChIKey is AICQYJFTGXHMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO6S/c1-11-5-7-12(8-6-11)25(20,21)18-15-14(22-2)10-9-13(16(15)23-3)17(19)24-4/h5-10,18H,1-4H3.
What are the key properties of methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate?
methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate has a molecular weight of 365.41 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethoxy-3-[(4-methylphenyl)sulfonylamino]benzoate is sourced from PubChem (CID 139249633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).