C14H13NO — CID 658410
2-(4-methylanilino)cyclohepta-2,4,6-trien-1-one (PubChem CID 658410) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(4-methylanilino)cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-(4-methylanilino)cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 658410 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(4-methylanilino)cyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1ccc(Nc2cccccc2=O)cc1 |
| InChI | InChI=1S/C14H13NO/c1-11-7-9-12(10-8-11)15-13-5-3-2-4-6-14(13)16/h2-10H,1H3,(H,15,16) |
| InChIKey | OCPDYWQXVYDNJK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |